C23H36N4O3 — CID 75306580
N,N-dimethyl-4-[2-[4-[3-(2-methylpyrrolidin-1-yl)propoxy]phenyl]-2-oxoethyl]piperazine-1-carboxamide (PubChem CID 75306580) has the molecular formula C23H36N4O3 and a molecular weight of 416.57 g/mol. Its IUPAC name is N,N-dimethyl-4-[2-[4-[3-(2-methylpyrrolidin-1-yl)propoxy]phenyl]-2-oxoethyl]piperazine-1-carboxamide.
| Compound Name | N,N-dimethyl-4-[2-[4-[3-(2-methylpyrrolidin-1-yl)propoxy]phenyl]-2-oxoethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 75306580 |
| Molecular Formula | C23H36N4O3 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.28 |
| IUPAC Name | N,N-dimethyl-4-[2-[4-[3-(2-methylpyrrolidin-1-yl)propoxy]phenyl]-2-oxoethyl]piperazine-1-carboxamide |
| SMILES | CC1CCCN1CCCOc1ccc(C(=O)CN2CCN(C(=O)N(C)C)CC2)cc1 |
| InChI | InChI=1S/C23H36N4O3/c1-19-6-4-11-26(19)12-5-17-30-21-9-7-20(8-10-21)22(28)18-25-13-15-27(16-14-25)23(29)24(2)3/h7-10,19H,4-6,11-18H2,1-3H3 |
| InChIKey | MWNSOTSCSZQZMD-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 56.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|