C20H29ClN2O3 — CID 66847587
1-[2-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]phenyl]-2-oxoethyl]pyrrolidin-2-one;hydrochloride (PubChem CID 66847587) has the molecular formula C20H29ClN2O3 and a molecular weight of 380.92 g/mol. Its IUPAC name is 1-[2-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]phenyl]-2-oxoethyl]pyrrolidin-2-one;hydrochloride.
| Compound Name | 1-[2-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]phenyl]-2-oxoethyl]pyrrolidin-2-one;hydrochloride |
|---|---|
| PubChem CID | 66847587 |
| Molecular Formula | C20H29ClN2O3 |
| Molecular Weight | 380.92 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | 1-[2-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]phenyl]-2-oxoethyl]pyrrolidin-2-one;hydrochloride |
| SMILES | C[C@@H]1CCCN1CCCOc1ccc(C(=O)CN2CCCC2=O)cc1.Cl |
| InChI | InChI=1S/C20H28N2O3.ClH/c1-16-5-2-11-21(16)13-4-14-25-18-9-7-17(8-10-18)19(23)15-22-12-3-6-20(22)24;/h7-10,16H,2-6,11-15H2,1H3;1H/t16-;/m1./s1 |
| InChIKey | YPJQYBSZSWMWMZ-PKLMIRHRSA-N |
| XLogP | 3.17 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.92 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|