C23H31NO — CID 91162955
3,3-dimethyl-1-[3-[4-(4-methylphenyl)phenoxy]propyl]piperidine (PubChem CID 91162955) has the molecular formula C23H31NO and a molecular weight of 337.51 g/mol. Its IUPAC name is 3,3-dimethyl-1-[3-[4-(4-methylphenyl)phenoxy]propyl]piperidine.
| Compound Name | 3,3-dimethyl-1-[3-[4-(4-methylphenyl)phenoxy]propyl]piperidine |
|---|---|
| PubChem CID | 91162955 |
| Molecular Formula | C23H31NO |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | 3,3-dimethyl-1-[3-[4-(4-methylphenyl)phenoxy]propyl]piperidine |
| SMILES | Cc1ccc(-c2ccc(OCCCN3CCCC(C)(C)C3)cc2)cc1 |
| InChI | InChI=1S/C23H31NO/c1-19-6-8-20(9-7-19)21-10-12-22(13-11-21)25-17-5-16-24-15-4-14-23(2,3)18-24/h6-13H,4-5,14-18H2,1-3H3 |
| InChIKey | FFTRTWZWUCUYOM-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|