C30H43N3O — CID 142884634
1-[1-(2,3-dimethylphenyl)ethenyl]-4-[4-[3-(3,3-dimethylpiperidin-1-yl)propoxy]phenyl]piperazine (PubChem CID 142884634) has the molecular formula C30H43N3O and a molecular weight of 461.69 g/mol. Its IUPAC name is 1-[1-(2,3-dimethylphenyl)ethenyl]-4-[4-[3-(3,3-dimethylpiperidin-1-yl)propoxy]phenyl]piperazine.
| Compound Name | 1-[1-(2,3-dimethylphenyl)ethenyl]-4-[4-[3-(3,3-dimethylpiperidin-1-yl)propoxy]phenyl]piperazine |
|---|---|
| PubChem CID | 142884634 |
| Molecular Formula | C30H43N3O |
| Molecular Weight | 461.69 g/mol |
| Exact Mass | 461.34 |
| IUPAC Name | 1-[1-(2,3-dimethylphenyl)ethenyl]-4-[4-[3-(3,3-dimethylpiperidin-1-yl)propoxy]phenyl]piperazine |
| SMILES | C=C(c1cccc(C)c1C)N1CCN(c2ccc(OCCCN3CCCC(C)(C)C3)cc2)CC1 |
| InChI | InChI=1S/C30H43N3O/c1-24-9-6-10-29(25(24)2)26(3)32-18-20-33(21-19-32)27-11-13-28(14-12-27)34-22-8-17-31-16-7-15-30(4,5)23-31/h6,9-14H,3,7-8,15-23H2,1-2,4-5H3 |
| InChIKey | GPNDCPYZSJGKIF-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.69 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|