C33H46F3N3O4 — CID 160698243
[4-[4-[3-(azocan-1-yl)propoxy]phenyl]piperazin-1-yl]-(5-methyl-2-propan-2-ylphenyl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 160698243) has the molecular formula C33H46F3N3O4 and a molecular weight of 605.74 g/mol. Its IUPAC name is [4-[4-[3-(azocan-1-yl)propoxy]phenyl]piperazin-1-yl]-(5-methyl-2-propan-2-ylphenyl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [4-[4-[3-(azocan-1-yl)propoxy]phenyl]piperazin-1-yl]-(5-methyl-2-propan-2-ylphenyl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 160698243 |
| Molecular Formula | C33H46F3N3O4 |
| Molecular Weight | 605.74 g/mol |
| Exact Mass | 605.34 |
| IUPAC Name | [4-[4-[3-(azocan-1-yl)propoxy]phenyl]piperazin-1-yl]-(5-methyl-2-propan-2-ylphenyl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc(C(C)C)c(C(=O)N2CCN(c3ccc(OCCCN4CCCCCCC4)cc3)CC2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C31H45N3O2.C2HF3O2/c1-25(2)29-15-10-26(3)24-30(29)31(35)34-21-19-33(20-22-34)27-11-13-28(14-12-27)36-23-9-18-32-16-7-5-4-6-8-17-32;3-2(4,5)1(6)7/h10-15,24-25H,4-9,16-23H2,1-3H3;(H,6,7) |
| InChIKey | IRHCQJGMWSZUPS-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.74 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|