C29H37FN4O2 — CID 174480797
(5-fluoro-1-methylindol-3-yl)-[4-[4-[3-(3-methylpiperidin-1-yl)propoxy]phenyl]piperazin-1-yl]methanone (PubChem CID 174480797) has the molecular formula C29H37FN4O2 and a molecular weight of 492.64 g/mol. Its IUPAC name is (5-fluoro-1-methylindol-3-yl)-[4-[4-[3-(3-methylpiperidin-1-yl)propoxy]phenyl]piperazin-1-yl]methanone.
| Compound Name | (5-fluoro-1-methylindol-3-yl)-[4-[4-[3-(3-methylpiperidin-1-yl)propoxy]phenyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 174480797 |
| Molecular Formula | C29H37FN4O2 |
| Molecular Weight | 492.64 g/mol |
| Exact Mass | 492.29 |
| IUPAC Name | (5-fluoro-1-methylindol-3-yl)-[4-[4-[3-(3-methylpiperidin-1-yl)propoxy]phenyl]piperazin-1-yl]methanone |
| SMILES | CC1CCCN(CCCOc2ccc(N3CCN(C(=O)c4cn(C)c5ccc(F)cc45)CC3)cc2)C1 |
| InChI | InChI=1S/C29H37FN4O2/c1-22-5-3-12-32(20-22)13-4-18-36-25-9-7-24(8-10-25)33-14-16-34(17-15-33)29(35)27-21-31(2)28-11-6-23(30)19-26(27)28/h6-11,19,21-22H,3-5,12-18,20H2,1-2H3 |
| InChIKey | HCTCJSIPNHBZFC-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 40.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.64 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|