C21H28N2O2 — CID 67281880
1-methyl-4-[4-[3-[(3R)-3-methylpiperidin-1-yl]propoxy]phenyl]pyridin-2-one (PubChem CID 67281880) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is 1-methyl-4-[4-[3-[(3R)-3-methylpiperidin-1-yl]propoxy]phenyl]pyridin-2-one.
| Compound Name | 1-methyl-4-[4-[3-[(3R)-3-methylpiperidin-1-yl]propoxy]phenyl]pyridin-2-one |
|---|---|
| PubChem CID | 67281880 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | 1-methyl-4-[4-[3-[(3R)-3-methylpiperidin-1-yl]propoxy]phenyl]pyridin-2-one |
| SMILES | C[C@@H]1CCCN(CCCOc2ccc(-c3ccn(C)c(=O)c3)cc2)C1 |
| InChI | InChI=1S/C21H28N2O2/c1-17-5-3-11-23(16-17)12-4-14-25-20-8-6-18(7-9-20)19-10-13-22(2)21(24)15-19/h6-10,13,15,17H,3-5,11-12,14,16H2,1-2H3/t17-/m1/s1 |
| InChIKey | GVXWMDZHYBAQJP-QGZVFWFLSA-N |
| XLogP | 3.55 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|