C21H34N2O — CID 143322433
4-[4-[3-[(3S)-3-methylpiperidin-1-yl]propoxy]phenyl]cyclohexan-1-amine (PubChem CID 143322433) has the molecular formula C21H34N2O and a molecular weight of 330.52 g/mol. Its IUPAC name is 4-[4-[3-[(3S)-3-methylpiperidin-1-yl]propoxy]phenyl]cyclohexan-1-amine.
| Compound Name | 4-[4-[3-[(3S)-3-methylpiperidin-1-yl]propoxy]phenyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 143322433 |
| Molecular Formula | C21H34N2O |
| Molecular Weight | 330.52 g/mol |
| Exact Mass | 330.27 |
| IUPAC Name | 4-[4-[3-[(3S)-3-methylpiperidin-1-yl]propoxy]phenyl]cyclohexan-1-amine |
| SMILES | C[C@H]1CCCN(CCCOc2ccc(C3CCC(N)CC3)cc2)C1 |
| InChI | InChI=1S/C21H34N2O/c1-17-4-2-13-23(16-17)14-3-15-24-21-11-7-19(8-12-21)18-5-9-20(22)10-6-18/h7-8,11-12,17-18,20H,2-6,9-10,13-16,22H2,1H3/t17-,18?,20?/m0/s1 |
| InChIKey | KWHQVAQGMSDYTD-ZJRDLVKKSA-N |
| XLogP | 4.17 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.52 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|