C20H32FN5 — CID 111056970
4-(4-fluorophenyl)-N'-[3-(3-methylpiperidin-1-yl)propyl]piperazine-1-carboximidamide (PubChem CID 111056970) has the molecular formula C20H32FN5 and a molecular weight of 361.51 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N'-[3-(3-methylpiperidin-1-yl)propyl]piperazine-1-carboximidamide.
| Compound Name | 4-(4-fluorophenyl)-N'-[3-(3-methylpiperidin-1-yl)propyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111056970 |
| Molecular Formula | C20H32FN5 |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.26 |
| IUPAC Name | 4-(4-fluorophenyl)-N'-[3-(3-methylpiperidin-1-yl)propyl]piperazine-1-carboximidamide |
| SMILES | CC1CCCN(CCC/N=C(\N)N2CCN(c3ccc(F)cc3)CC2)C1 |
| InChI | InChI=1S/C20H32FN5/c1-17-4-2-10-24(16-17)11-3-9-23-20(22)26-14-12-25(13-15-26)19-7-5-18(21)6-8-19/h5-8,17H,2-4,9-16H2,1H3,(H2,22,23) |
| InChIKey | SUVHAFLVNFRILC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 48.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|