C25H31F2N3O2 — CID 59250125
(2,5-difluorophenyl)-[4-[4-(3-piperidin-1-ylpropoxy)phenyl]piperazin-1-yl]methanone (PubChem CID 59250125) has the molecular formula C25H31F2N3O2 and a molecular weight of 443.54 g/mol. Its IUPAC name is (2,5-difluorophenyl)-[4-[4-(3-piperidin-1-ylpropoxy)phenyl]piperazin-1-yl]methanone.
| Compound Name | (2,5-difluorophenyl)-[4-[4-(3-piperidin-1-ylpropoxy)phenyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 59250125 |
| Molecular Formula | C25H31F2N3O2 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | (2,5-difluorophenyl)-[4-[4-(3-piperidin-1-ylpropoxy)phenyl]piperazin-1-yl]methanone |
| SMILES | O=C(c1cc(F)ccc1F)N1CCN(c2ccc(OCCCN3CCCCC3)cc2)CC1 |
| InChI | InChI=1S/C25H31F2N3O2/c26-20-5-10-24(27)23(19-20)25(31)30-16-14-29(15-17-30)21-6-8-22(9-7-21)32-18-4-13-28-11-2-1-3-12-28/h5-10,19H,1-4,11-18H2 |
| InChIKey | QRYOOOKIEPFJGT-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|