C29H35F3N2O6 — CID 66783819
6-methoxy-1'-[4-(3-piperidin-1-ylpropoxy)phenyl]spiro[2-benzofuran-3,4'-piperidine]-1-one;2,2,2-trifluoroacetic acid (PubChem CID 66783819) has the molecular formula C29H35F3N2O6 and a molecular weight of 564.60 g/mol. Its IUPAC name is 6-methoxy-1'-[4-(3-piperidin-1-ylpropoxy)phenyl]spiro[2-benzofuran-3,4'-piperidine]-1-one;2,2,2-trifluoroacetic acid.
| Compound Name | 6-methoxy-1'-[4-(3-piperidin-1-ylpropoxy)phenyl]spiro[2-benzofuran-3,4'-piperidine]-1-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 66783819 |
| Molecular Formula | C29H35F3N2O6 |
| Molecular Weight | 564.60 g/mol |
| Exact Mass | 564.24 |
| IUPAC Name | 6-methoxy-1'-[4-(3-piperidin-1-ylpropoxy)phenyl]spiro[2-benzofuran-3,4'-piperidine]-1-one;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc2c(c1)C(=O)OC21CCN(c2ccc(OCCCN3CCCCC3)cc2)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C27H34N2O4.C2HF3O2/c1-31-23-10-11-25-24(20-23)26(30)33-27(25)12-17-29(18-13-27)21-6-8-22(9-7-21)32-19-5-16-28-14-3-2-4-15-28;3-2(4,5)1(6)7/h6-11,20H,2-5,12-19H2,1H3;(H,6,7) |
| InChIKey | BXOAYBFCUXJSIR-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.60 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|