C27H34N2O4 — CID 66783820
6-methoxy-1'-[4-(3-piperidin-1-ylpropoxy)phenyl]spiro[2-benzofuran-3,4'-piperidine]-1-one (PubChem CID 66783820) has the molecular formula C27H34N2O4 and a molecular weight of 450.58 g/mol. Its IUPAC name is 6-methoxy-1'-[4-(3-piperidin-1-ylpropoxy)phenyl]spiro[2-benzofuran-3,4'-piperidine]-1-one.
| Compound Name | 6-methoxy-1'-[4-(3-piperidin-1-ylpropoxy)phenyl]spiro[2-benzofuran-3,4'-piperidine]-1-one |
|---|---|
| PubChem CID | 66783820 |
| Molecular Formula | C27H34N2O4 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | 6-methoxy-1'-[4-(3-piperidin-1-ylpropoxy)phenyl]spiro[2-benzofuran-3,4'-piperidine]-1-one |
| SMILES | COc1ccc2c(c1)C(=O)OC21CCN(c2ccc(OCCCN3CCCCC3)cc2)CC1 |
| InChI | InChI=1S/C27H34N2O4/c1-31-23-10-11-25-24(20-23)26(30)33-27(25)12-17-29(18-13-27)21-6-8-22(9-7-21)32-19-5-16-28-14-3-2-4-15-28/h6-11,20H,2-5,12-19H2,1H3 |
| InChIKey | UWUAJDARFSLFOO-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|