C26H36N2O3 — CID 66783418
4-(3-methoxyphenyl)-1-[4-(3-piperidin-1-ylpropoxy)phenyl]piperidin-4-ol (PubChem CID 66783418) has the molecular formula C26H36N2O3 and a molecular weight of 424.59 g/mol. Its IUPAC name is 4-(3-methoxyphenyl)-1-[4-(3-piperidin-1-ylpropoxy)phenyl]piperidin-4-ol.
| Compound Name | 4-(3-methoxyphenyl)-1-[4-(3-piperidin-1-ylpropoxy)phenyl]piperidin-4-ol |
|---|---|
| PubChem CID | 66783418 |
| Molecular Formula | C26H36N2O3 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.27 |
| IUPAC Name | 4-(3-methoxyphenyl)-1-[4-(3-piperidin-1-ylpropoxy)phenyl]piperidin-4-ol |
| SMILES | COc1cccc(C2(O)CCN(c3ccc(OCCCN4CCCCC4)cc3)CC2)c1 |
| InChI | InChI=1S/C26H36N2O3/c1-30-25-8-5-7-22(21-25)26(29)13-18-28(19-14-26)23-9-11-24(12-10-23)31-20-6-17-27-15-3-2-4-16-27/h5,7-12,21,29H,2-4,6,13-20H2,1H3 |
| InChIKey | SIDCSPOXCBHKRF-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|