C28H35F3N2O5 — CID 140537005
[4-hydroxy-4-(4-methoxyphenyl)-1-[4-(3-piperidin-1-ylpropoxy)phenyl]piperidin-2-yl] 2,2,2-trifluoroacetate (PubChem CID 140537005) has the molecular formula C28H35F3N2O5 and a molecular weight of 536.59 g/mol. Its IUPAC name is [4-hydroxy-4-(4-methoxyphenyl)-1-[4-(3-piperidin-1-ylpropoxy)phenyl]piperidin-2-yl] 2,2,2-trifluoroacetate.
| Compound Name | [4-hydroxy-4-(4-methoxyphenyl)-1-[4-(3-piperidin-1-ylpropoxy)phenyl]piperidin-2-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 140537005 |
| Molecular Formula | C28H35F3N2O5 |
| Molecular Weight | 536.59 g/mol |
| Exact Mass | 536.25 |
| IUPAC Name | [4-hydroxy-4-(4-methoxyphenyl)-1-[4-(3-piperidin-1-ylpropoxy)phenyl]piperidin-2-yl] 2,2,2-trifluoroacetate |
| SMILES | COc1ccc(C2(O)CCN(c3ccc(OCCCN4CCCCC4)cc3)C(OC(=O)C(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C28H35F3N2O5/c1-36-23-10-6-21(7-11-23)27(35)14-18-33(25(20-27)38-26(34)28(29,30)31)22-8-12-24(13-9-22)37-19-5-17-32-15-3-2-4-16-32/h6-13,25,35H,2-5,14-20H2,1H3 |
| InChIKey | WXZPWFCUOCLGTJ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 71.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.59 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|