C33H37F3N2O3 — CID 140537009
[4,4-diphenyl-1-[4-(3-piperidin-1-ylpropoxy)phenyl]piperidin-2-yl] 2,2,2-trifluoroacetate (PubChem CID 140537009) has the molecular formula C33H37F3N2O3 and a molecular weight of 566.66 g/mol. Its IUPAC name is [4,4-diphenyl-1-[4-(3-piperidin-1-ylpropoxy)phenyl]piperidin-2-yl] 2,2,2-trifluoroacetate.
| Compound Name | [4,4-diphenyl-1-[4-(3-piperidin-1-ylpropoxy)phenyl]piperidin-2-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 140537009 |
| Molecular Formula | C33H37F3N2O3 |
| Molecular Weight | 566.66 g/mol |
| Exact Mass | 566.28 |
| IUPAC Name | [4,4-diphenyl-1-[4-(3-piperidin-1-ylpropoxy)phenyl]piperidin-2-yl] 2,2,2-trifluoroacetate |
| SMILES | O=C(OC1CC(c2ccccc2)(c2ccccc2)CCN1c1ccc(OCCCN2CCCCC2)cc1)C(F)(F)F |
| InChI | InChI=1S/C33H37F3N2O3/c34-33(35,36)31(39)41-30-25-32(26-11-4-1-5-12-26,27-13-6-2-7-14-27)19-23-38(30)28-15-17-29(18-16-28)40-24-10-22-37-20-8-3-9-21-37/h1-2,4-7,11-18,30H,3,8-10,19-25H2 |
| InChIKey | SQKZMXXTQNDCCR-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.66 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|