C17H21N3O3 — CID 152783651
1-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]pyrazole-4-carboxylic acid (PubChem CID 152783651) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is 1-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]pyrazole-4-carboxylic acid.
| Compound Name | 1-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 152783651 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 1-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]pyrazole-4-carboxylic acid |
| SMILES | O=C(O)c1cnn(-c2ccc(OCCCN3CCCC3)cc2)c1 |
| InChI | InChI=1S/C17H21N3O3/c21-17(22)14-12-18-20(13-14)15-4-6-16(7-5-15)23-11-3-10-19-8-1-2-9-19/h4-7,12-13H,1-3,8-11H2,(H,21,22) |
| InChIKey | RSHMPPFRBNTZJP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|