C23H34N4O2 — CID 42610477
N-tert-butyl-1-[4-[3-(2,5-dimethylpyrrolidin-1-yl)propoxy]phenyl]pyrazole-4-carboxamide (PubChem CID 42610477) has the molecular formula C23H34N4O2 and a molecular weight of 398.55 g/mol. Its IUPAC name is N-tert-butyl-1-[4-[3-(2,5-dimethylpyrrolidin-1-yl)propoxy]phenyl]pyrazole-4-carboxamide.
| Compound Name | N-tert-butyl-1-[4-[3-(2,5-dimethylpyrrolidin-1-yl)propoxy]phenyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 42610477 |
| Molecular Formula | C23H34N4O2 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | N-tert-butyl-1-[4-[3-(2,5-dimethylpyrrolidin-1-yl)propoxy]phenyl]pyrazole-4-carboxamide |
| SMILES | CC1CCC(C)N1CCCOc1ccc(-n2cc(C(=O)NC(C)(C)C)cn2)cc1 |
| InChI | InChI=1S/C23H34N4O2/c1-17-7-8-18(2)26(17)13-6-14-29-21-11-9-20(10-12-21)27-16-19(15-24-27)22(28)25-23(3,4)5/h9-12,15-18H,6-8,13-14H2,1-5H3,(H,25,28) |
| InChIKey | ULYGNJDYFKUSCV-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|