C26H42N4O3Si — CID 59541712
N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]phenyl]pyrazole-4-carboxamide (PubChem CID 59541712) has the molecular formula C26H42N4O3Si and a molecular weight of 486.73 g/mol. Its IUPAC name is N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]phenyl]pyrazole-4-carboxamide.
| Compound Name | N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]phenyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 59541712 |
| Molecular Formula | C26H42N4O3Si |
| Molecular Weight | 486.73 g/mol |
| Exact Mass | 486.30 |
| IUPAC Name | N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]phenyl]pyrazole-4-carboxamide |
| SMILES | C[C@@H]1CCCN1CCCOc1ccc(-n2cc(C(=O)NCCO[Si](C)(C)C(C)(C)C)cn2)cc1 |
| InChI | InChI=1S/C26H42N4O3Si/c1-21-9-7-15-29(21)16-8-17-32-24-12-10-23(11-13-24)30-20-22(19-28-30)25(31)27-14-18-33-34(5,6)26(2,3)4/h10-13,19-21H,7-9,14-18H2,1-6H3,(H,27,31)/t21-/m1/s1 |
| InChIKey | UJERKMPVEJMWPQ-OAQYLSRUSA-N |
| XLogP | 4.88 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.73 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|