C28H37F3N2O3 — CID 69241278
[4-(dimethylamino)-1-phenyl-2-[4-(3-piperidin-1-ylpropoxy)phenyl]butan-2-yl] 2,2,2-trifluoroacetate (PubChem CID 69241278) has the molecular formula C28H37F3N2O3 and a molecular weight of 506.61 g/mol. Its IUPAC name is [4-(dimethylamino)-1-phenyl-2-[4-(3-piperidin-1-ylpropoxy)phenyl]butan-2-yl] 2,2,2-trifluoroacetate.
| Compound Name | [4-(dimethylamino)-1-phenyl-2-[4-(3-piperidin-1-ylpropoxy)phenyl]butan-2-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 69241278 |
| Molecular Formula | C28H37F3N2O3 |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.28 |
| IUPAC Name | [4-(dimethylamino)-1-phenyl-2-[4-(3-piperidin-1-ylpropoxy)phenyl]butan-2-yl] 2,2,2-trifluoroacetate |
| SMILES | CN(C)CCC(Cc1ccccc1)(OC(=O)C(F)(F)F)c1ccc(OCCCN2CCCCC2)cc1 |
| InChI | InChI=1S/C28H37F3N2O3/c1-32(2)20-16-27(36-26(34)28(29,30)31,22-23-10-5-3-6-11-23)24-12-14-25(15-13-24)35-21-9-19-33-17-7-4-8-18-33/h3,5-6,10-15H,4,7-9,16-22H2,1-2H3 |
| InChIKey | JVCCKSWXNZKBPH-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|