C33H43N3O4 — CID 157151232
[4-[2-[4-[3-(azepan-1-yl)propoxy]phenyl]ethyl]piperazin-1-yl]-naphthalen-1-ylmethanone;formic acid (PubChem CID 157151232) has the molecular formula C33H43N3O4 and a molecular weight of 545.72 g/mol. Its IUPAC name is [4-[2-[4-[3-(azepan-1-yl)propoxy]phenyl]ethyl]piperazin-1-yl]-naphthalen-1-ylmethanone;formic acid.
| Compound Name | [4-[2-[4-[3-(azepan-1-yl)propoxy]phenyl]ethyl]piperazin-1-yl]-naphthalen-1-ylmethanone;formic acid |
|---|---|
| PubChem CID | 157151232 |
| Molecular Formula | C33H43N3O4 |
| Molecular Weight | 545.72 g/mol |
| Exact Mass | 545.33 |
| IUPAC Name | [4-[2-[4-[3-(azepan-1-yl)propoxy]phenyl]ethyl]piperazin-1-yl]-naphthalen-1-ylmethanone;formic acid |
| SMILES | O=C(c1cccc2ccccc12)N1CCN(CCc2ccc(OCCCN3CCCCCC3)cc2)CC1.O=CO |
| InChI | InChI=1S/C32H41N3O2.CH2O2/c36-32(31-12-7-10-28-9-3-4-11-30(28)31)35-24-22-34(23-25-35)21-17-27-13-15-29(16-14-27)37-26-8-20-33-18-5-1-2-6-19-33;2-1-3/h3-4,7,9-16H,1-2,5-6,8,17-26H2;1H,(H,2,3) |
| InChIKey | ALGVIVMUYMLWCF-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.72 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|