C35H44N4O5 — CID 68930206
3-[8-[4-[2-[4-[3-(azepan-1-yl)propoxy]phenyl]ethyl]piperazin-1-yl]quinolin-2-yl]-2-methoxycarbonylprop-2-enoic acid (PubChem CID 68930206) has the molecular formula C35H44N4O5 and a molecular weight of 600.76 g/mol. Its IUPAC name is 3-[8-[4-[2-[4-[3-(azepan-1-yl)propoxy]phenyl]ethyl]piperazin-1-yl]quinolin-2-yl]-2-methoxycarbonylprop-2-enoic acid.
| Compound Name | 3-[8-[4-[2-[4-[3-(azepan-1-yl)propoxy]phenyl]ethyl]piperazin-1-yl]quinolin-2-yl]-2-methoxycarbonylprop-2-enoic acid |
|---|---|
| PubChem CID | 68930206 |
| Molecular Formula | C35H44N4O5 |
| Molecular Weight | 600.76 g/mol |
| Exact Mass | 600.33 |
| IUPAC Name | 3-[8-[4-[2-[4-[3-(azepan-1-yl)propoxy]phenyl]ethyl]piperazin-1-yl]quinolin-2-yl]-2-methoxycarbonylprop-2-enoic acid |
| SMILES | COC(=O)C(=Cc1ccc2cccc(N3CCN(CCc4ccc(OCCCN5CCCCCC5)cc4)CC3)c2n1)C(=O)O |
| InChI | InChI=1S/C35H44N4O5/c1-43-35(42)31(34(40)41)26-29-13-12-28-8-6-9-32(33(28)36-29)39-23-21-38(22-24-39)20-16-27-10-14-30(15-11-27)44-25-7-19-37-17-4-2-3-5-18-37/h6,8-15,26H,2-5,7,16-25H2,1H3,(H,40,41) |
| InChIKey | SNADEHOQURCCAN-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 95.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.76 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|