C35H46N4O3 — CID 90691871
ethyl 3-[8-[4-[2-[4-[3-(azepan-1-yl)propoxy]phenyl]ethyl]piperazin-1-yl]quinolin-2-yl]prop-2-enoate (PubChem CID 90691871) has the molecular formula C35H46N4O3 and a molecular weight of 570.78 g/mol. Its IUPAC name is ethyl 3-[8-[4-[2-[4-[3-(azepan-1-yl)propoxy]phenyl]ethyl]piperazin-1-yl]quinolin-2-yl]prop-2-enoate.
| Compound Name | ethyl 3-[8-[4-[2-[4-[3-(azepan-1-yl)propoxy]phenyl]ethyl]piperazin-1-yl]quinolin-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 90691871 |
| Molecular Formula | C35H46N4O3 |
| Molecular Weight | 570.78 g/mol |
| Exact Mass | 570.36 |
| IUPAC Name | ethyl 3-[8-[4-[2-[4-[3-(azepan-1-yl)propoxy]phenyl]ethyl]piperazin-1-yl]quinolin-2-yl]prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1ccc2cccc(N3CCN(CCc4ccc(OCCCN5CCCCCC5)cc4)CC3)c2n1 |
| InChI | InChI=1S/C35H46N4O3/c1-2-41-34(40)18-15-31-14-13-30-9-7-10-33(35(30)36-31)39-26-24-38(25-27-39)23-19-29-11-16-32(17-12-29)42-28-8-22-37-20-5-3-4-6-21-37/h7,9-18H,2-6,8,19-28H2,1H3 |
| InChIKey | HWHBNGUKODWNKB-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 58.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.78 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|