C17H26N2O2 — CID 95729851
(5R)-7-[(2,3-dimethoxyphenyl)methyl]-2,7-diazaspiro[4.5]decane (PubChem CID 95729851) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is (5R)-7-[(2,3-dimethoxyphenyl)methyl]-2,7-diazaspiro[4.5]decane.
| Compound Name | (5R)-7-[(2,3-dimethoxyphenyl)methyl]-2,7-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 95729851 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | (5R)-7-[(2,3-dimethoxyphenyl)methyl]-2,7-diazaspiro[4.5]decane |
| SMILES | COc1cccc(CN2CCC[C@]3(CCNC3)C2)c1OC |
| InChI | InChI=1S/C17H26N2O2/c1-20-15-6-3-5-14(16(15)21-2)11-19-10-4-7-17(13-19)8-9-18-12-17/h3,5-6,18H,4,7-13H2,1-2H3/t17-/m1/s1 |
| InChIKey | NKUYAZRISCZEEP-QGZVFWFLSA-N |
| XLogP | 2.28 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |