C21H30N2O3 — CID 45229052
1-[9-[(2,3-dimethoxyphenyl)methyl]-2,9-diazaspiro[4.5]decan-2-yl]but-3-en-1-one (PubChem CID 45229052) has the molecular formula C21H30N2O3 and a molecular weight of 358.48 g/mol. Its IUPAC name is 1-[9-[(2,3-dimethoxyphenyl)methyl]-2,9-diazaspiro[4.5]decan-2-yl]but-3-en-1-one.
| Compound Name | 1-[9-[(2,3-dimethoxyphenyl)methyl]-2,9-diazaspiro[4.5]decan-2-yl]but-3-en-1-one |
|---|---|
| PubChem CID | 45229052 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | 1-[9-[(2,3-dimethoxyphenyl)methyl]-2,9-diazaspiro[4.5]decan-2-yl]but-3-en-1-one |
| SMILES | C=CCC(=O)N1CCC2(CCCN(Cc3cccc(OC)c3OC)C2)C1 |
| InChI | InChI=1S/C21H30N2O3/c1-4-7-19(24)23-13-11-21(16-23)10-6-12-22(15-21)14-17-8-5-9-18(25-2)20(17)26-3/h4-5,8-9H,1,6-7,10-16H2,2-3H3 |
| InChIKey | OXNTVVMQXVUVHB-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|