C23H28N2O5 — CID 45229319
1-[9-[(2,3-dimethoxyphenyl)methyl]-2,9-diazaspiro[4.5]decan-2-yl]-2-(furan-2-yl)ethane-1,2-dione (PubChem CID 45229319) has the molecular formula C23H28N2O5 and a molecular weight of 412.49 g/mol. Its IUPAC name is 1-[9-[(2,3-dimethoxyphenyl)methyl]-2,9-diazaspiro[4.5]decan-2-yl]-2-(furan-2-yl)ethane-1,2-dione.
| Compound Name | 1-[9-[(2,3-dimethoxyphenyl)methyl]-2,9-diazaspiro[4.5]decan-2-yl]-2-(furan-2-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 45229319 |
| Molecular Formula | C23H28N2O5 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 1-[9-[(2,3-dimethoxyphenyl)methyl]-2,9-diazaspiro[4.5]decan-2-yl]-2-(furan-2-yl)ethane-1,2-dione |
| SMILES | COc1cccc(CN2CCCC3(CCN(C(=O)C(=O)c4ccco4)C3)C2)c1OC |
| InChI | InChI=1S/C23H28N2O5/c1-28-19-7-3-6-17(21(19)29-2)14-24-11-5-9-23(15-24)10-12-25(16-23)22(27)20(26)18-8-4-13-30-18/h3-4,6-8,13H,5,9-12,14-16H2,1-2H3 |
| InChIKey | QFUPBUDVEXEQNM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 72.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|