About (5S)-2-[(5-chloro-2,3-dimethoxyphenyl)methyl]-2,9-diazaspiro[4.5]decane
(5S)-2-[(5-chloro-2,3-dimethoxyphenyl)methyl]-2,9-diazaspiro[4.5]decane (PubChem CID 95227016) has the molecular formula C17H25ClN2O2
and a molecular weight of 324.85 g/mol. Its IUPAC name is (5S)-2-[(5-chloro-2,3-dimethoxyphenyl)methyl]-2,9-diazaspiro[4.5]decane.
Molecular Properties
| Compound Name | (5S)-2-[(5-chloro-2,3-dimethoxyphenyl)methyl]-2,9-diazaspiro[4.5]decane |
| PubChem CID | 95227016 |
| Molecular Formula | C17H25ClN2O2 |
| Molecular Weight | 324.85 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | (5S)-2-[(5-chloro-2,3-dimethoxyphenyl)methyl]-2,9-diazaspiro[4.5]decane |
| SMILES | COc1cc(Cl)cc(CN2CC[C@]3(CCCNC3)C2)c1OC |
| InChI | InChI=1S/C17H25ClN2O2/c1-21-15-9-14(18)8-13(16(15)22-2)10-20-7-5-17(12-20)4-3-6-19-11-17/h8-9,19H,3-7,10-12H2,1-2H3/t17-/m0/s1 |
| InChIKey | WTFSBQDMXYTQKJ-KRWDZBQOSA-N |
| XLogP | 2.93 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.85 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5S)-2-[(5-chloro-2,3-dimethoxyphenyl)methyl]-2,9-diazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-2-[(5-chloro-2,3-dimethoxyphenyl)methyl]-2,9-diazaspiro[4.5]decane?
The IUPAC name of (5S)-2-[(5-chloro-2,3-dimethoxyphenyl)methyl]-2,9-diazaspiro[4.5]decane (CID 95227016) is (5S)-2-[(5-chloro-2,3-dimethoxyphenyl)methyl]-2,9-diazaspiro[4.5]decane.
What is the SMILES notation for (5S)-2-[(5-chloro-2,3-dimethoxyphenyl)methyl]-2,9-diazaspiro[4.5]decane?
The canonical SMILES for (5S)-2-[(5-chloro-2,3-dimethoxyphenyl)methyl]-2,9-diazaspiro[4.5]decane is COc1cc(Cl)cc(CN2CC[C@]3(CCCNC3)C2)c1OC.
What is the InChIKey of (5S)-2-[(5-chloro-2,3-dimethoxyphenyl)methyl]-2,9-diazaspiro[4.5]decane?
The InChIKey is WTFSBQDMXYTQKJ-KRWDZBQOSA-N. The full InChI is InChI=1S/C17H25ClN2O2/c1-21-15-9-14(18)8-13(16(15)22-2)10-20-7-5-17(12-20)4-3-6-19-11-17/h8-9,19H,3-7,10-12H2,1-2H3/t17-/m0/s1.
What are the key properties of (5S)-2-[(5-chloro-2,3-dimethoxyphenyl)methyl]-2,9-diazaspiro[4.5]decane?
(5S)-2-[(5-chloro-2,3-dimethoxyphenyl)methyl]-2,9-diazaspiro[4.5]decane has a molecular weight of 324.85 g/mol, XLogP of 2.93, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-2-[(5-chloro-2,3-dimethoxyphenyl)methyl]-2,9-diazaspiro[4.5]decane is sourced from PubChem (CID 95227016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).