C16H22Cl2N2 — CID 82038748
2-[(2,5-dichlorophenyl)methyl]-2,8-diazaspiro[5.5]undecane (PubChem CID 82038748) has the molecular formula C16H22Cl2N2 and a molecular weight of 313.27 g/mol. Its IUPAC name is 2-[(2,5-dichlorophenyl)methyl]-2,8-diazaspiro[5.5]undecane.
| Compound Name | 2-[(2,5-dichlorophenyl)methyl]-2,8-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 82038748 |
| Molecular Formula | C16H22Cl2N2 |
| Molecular Weight | 313.27 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 2-[(2,5-dichlorophenyl)methyl]-2,8-diazaspiro[5.5]undecane |
| SMILES | Clc1ccc(Cl)c(CN2CCCC3(CCCNC3)C2)c1 |
| InChI | InChI=1S/C16H22Cl2N2/c17-14-3-4-15(18)13(9-14)10-20-8-2-6-16(12-20)5-1-7-19-11-16/h3-4,9,19H,1-2,5-8,10-12H2 |
| InChIKey | LRINYSGDCYXNFF-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.27 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |