C14H18Cl2N2 — CID 82038699
2-[(2,4-dichlorophenyl)methyl]-2,7-diazaspiro[4.4]nonane (PubChem CID 82038699) has the molecular formula C14H18Cl2N2 and a molecular weight of 285.22 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methyl]-2,7-diazaspiro[4.4]nonane.
| Compound Name | 2-[(2,4-dichlorophenyl)methyl]-2,7-diazaspiro[4.4]nonane |
|---|---|
| PubChem CID | 82038699 |
| Molecular Formula | C14H18Cl2N2 |
| Molecular Weight | 285.22 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methyl]-2,7-diazaspiro[4.4]nonane |
| SMILES | Clc1ccc(CN2CCC3(CCNC3)C2)c(Cl)c1 |
| InChI | InChI=1S/C14H18Cl2N2/c15-12-2-1-11(13(16)7-12)8-18-6-4-14(10-18)3-5-17-9-14/h1-2,7,17H,3-6,8-10H2 |
| InChIKey | YJSDDTJHCYKBHH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.22 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |