About 2-[(3-chloro-5-methoxy-4-propoxyphenyl)methyl]-2,7-diazaspiro[4.4]nonane
2-[(3-chloro-5-methoxy-4-propoxyphenyl)methyl]-2,7-diazaspiro[4.4]nonane (PubChem CID 120907704) has the molecular formula C18H27ClN2O2
and a molecular weight of 338.88 g/mol. Its IUPAC name is 2-[(3-chloro-5-methoxy-4-propoxyphenyl)methyl]-2,7-diazaspiro[4.4]nonane.
Molecular Properties
| Compound Name | 2-[(3-chloro-5-methoxy-4-propoxyphenyl)methyl]-2,7-diazaspiro[4.4]nonane |
| PubChem CID | 120907704 |
| Molecular Formula | C18H27ClN2O2 |
| Molecular Weight | 338.88 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | 2-[(3-chloro-5-methoxy-4-propoxyphenyl)methyl]-2,7-diazaspiro[4.4]nonane |
| SMILES | CCCOc1c(Cl)cc(CN2CCC3(CCNC3)C2)cc1OC |
| InChI | InChI=1S/C18H27ClN2O2/c1-3-8-23-17-15(19)9-14(10-16(17)22-2)11-21-7-5-18(13-21)4-6-20-12-18/h9-10,20H,3-8,11-13H2,1-2H3 |
| InChIKey | UURVYPJRISHPLD-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.88 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(3-chloro-5-methoxy-4-propoxyphenyl)methyl]-2,7-diazaspiro[4.4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3-chloro-5-methoxy-4-propoxyphenyl)methyl]-2,7-diazaspiro[4.4]nonane?
The IUPAC name of 2-[(3-chloro-5-methoxy-4-propoxyphenyl)methyl]-2,7-diazaspiro[4.4]nonane (CID 120907704) is 2-[(3-chloro-5-methoxy-4-propoxyphenyl)methyl]-2,7-diazaspiro[4.4]nonane.
What is the SMILES notation for 2-[(3-chloro-5-methoxy-4-propoxyphenyl)methyl]-2,7-diazaspiro[4.4]nonane?
The canonical SMILES for 2-[(3-chloro-5-methoxy-4-propoxyphenyl)methyl]-2,7-diazaspiro[4.4]nonane is CCCOc1c(Cl)cc(CN2CCC3(CCNC3)C2)cc1OC.
What is the InChIKey of 2-[(3-chloro-5-methoxy-4-propoxyphenyl)methyl]-2,7-diazaspiro[4.4]nonane?
The InChIKey is UURVYPJRISHPLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27ClN2O2/c1-3-8-23-17-15(19)9-14(10-16(17)22-2)11-21-7-5-18(13-21)4-6-20-12-18/h9-10,20H,3-8,11-13H2,1-2H3.
What are the key properties of 2-[(3-chloro-5-methoxy-4-propoxyphenyl)methyl]-2,7-diazaspiro[4.4]nonane?
2-[(3-chloro-5-methoxy-4-propoxyphenyl)methyl]-2,7-diazaspiro[4.4]nonane has a molecular weight of 338.88 g/mol, XLogP of 3.32, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-chloro-5-methoxy-4-propoxyphenyl)methyl]-2,7-diazaspiro[4.4]nonane is sourced from PubChem (CID 120907704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).