C17H25NO3 — CID 97159672
6-[(3,4,5-trimethoxyphenyl)methyl]-6-azaspiro[3.4]octane (PubChem CID 97159672) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is 6-[(3,4,5-trimethoxyphenyl)methyl]-6-azaspiro[3.4]octane.
| Compound Name | 6-[(3,4,5-trimethoxyphenyl)methyl]-6-azaspiro[3.4]octane |
|---|---|
| PubChem CID | 97159672 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 6-[(3,4,5-trimethoxyphenyl)methyl]-6-azaspiro[3.4]octane |
| SMILES | COc1cc(CN2CCC3(CCC3)C2)cc(OC)c1OC |
| InChI | InChI=1S/C17H25NO3/c1-19-14-9-13(10-15(20-2)16(14)21-3)11-18-8-7-17(12-18)5-4-6-17/h9-10H,4-8,11-12H2,1-3H3 |
| InChIKey | FCSDWMKXKUHSRB-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |