C20H29BO3 — CID 155789539
2-[2-[(E)-2-(2,2-dimethylcyclopropyl)ethenyl]-4-methoxyphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 155789539) has the molecular formula C20H29BO3 and a molecular weight of 328.26 g/mol. Its IUPAC name is 2-[2-[(E)-2-(2,2-dimethylcyclopropyl)ethenyl]-4-methoxyphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[2-[(E)-2-(2,2-dimethylcyclopropyl)ethenyl]-4-methoxyphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 155789539 |
| Molecular Formula | C20H29BO3 |
| Molecular Weight | 328.26 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | 2-[2-[(E)-2-(2,2-dimethylcyclopropyl)ethenyl]-4-methoxyphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | COc1ccc(B2OC(C)(C)C(C)(C)O2)c(/C=C/C2CC2(C)C)c1 |
| InChI | InChI=1S/C20H29BO3/c1-18(2)13-15(18)9-8-14-12-16(22-7)10-11-17(14)21-23-19(3,4)20(5,6)24-21/h8-12,15H,13H2,1-7H3/b9-8+ |
| InChIKey | LFZCHMAJEFXVNC-CMDGGOBGSA-N |
| XLogP | 4.05 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.26 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|