C26H25BF4N2O4S — CID 46896784
N-(4-fluorophenyl)-6-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethoxy)phenyl]methylsulfanyl]pyridine-3-carboxamide (PubChem CID 46896784) has the molecular formula C26H25BF4N2O4S and a molecular weight of 548.37 g/mol. Its IUPAC name is N-(4-fluorophenyl)-6-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethoxy)phenyl]methylsulfanyl]pyridine-3-carboxamide.
| Compound Name | N-(4-fluorophenyl)-6-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethoxy)phenyl]methylsulfanyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 46896784 |
| Molecular Formula | C26H25BF4N2O4S |
| Molecular Weight | 548.37 g/mol |
| Exact Mass | 548.16 |
| IUPAC Name | N-(4-fluorophenyl)-6-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethoxy)phenyl]methylsulfanyl]pyridine-3-carboxamide |
| SMILES | CC1(C)OB(c2ccc(OC(F)(F)F)cc2CSc2ccc(C(=O)Nc3ccc(F)cc3)cn2)OC1(C)C |
| InChI | InChI=1S/C26H25BF4N2O4S/c1-24(2)25(3,4)37-27(36-24)21-11-10-20(35-26(29,30)31)13-17(21)15-38-22-12-5-16(14-32-22)23(34)33-19-8-6-18(28)7-9-19/h5-14H,15H2,1-4H3,(H,33,34) |
| InChIKey | KUUXJYNTDOOIJP-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.37 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|