C17H19BFN3O3 — CID 71244611
N-(4-fluorophenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine-2-carboxamide (PubChem CID 71244611) has the molecular formula C17H19BFN3O3 and a molecular weight of 343.17 g/mol. Its IUPAC name is N-(4-fluorophenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine-2-carboxamide.
| Compound Name | N-(4-fluorophenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 71244611 |
| Molecular Formula | C17H19BFN3O3 |
| Molecular Weight | 343.17 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | N-(4-fluorophenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine-2-carboxamide |
| SMILES | CC1(C)OB(c2cnc(C(=O)Nc3ccc(F)cc3)nc2)OC1(C)C |
| InChI | InChI=1S/C17H19BFN3O3/c1-16(2)17(3,4)25-18(24-16)11-9-20-14(21-10-11)15(23)22-13-7-5-12(19)6-8-13/h5-10H,1-4H3,(H,22,23) |
| InChIKey | NNMYQEBDYCSONJ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.17 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|