C20H14BrFN2O2S — CID 91937266
6-[2-(3-bromophenyl)-2-oxoethyl]sulfanyl-N-(4-fluorophenyl)pyridine-3-carboxamide (PubChem CID 91937266) has the molecular formula C20H14BrFN2O2S and a molecular weight of 445.31 g/mol. Its IUPAC name is 6-[2-(3-bromophenyl)-2-oxoethyl]sulfanyl-N-(4-fluorophenyl)pyridine-3-carboxamide.
| Compound Name | 6-[2-(3-bromophenyl)-2-oxoethyl]sulfanyl-N-(4-fluorophenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 91937266 |
| Molecular Formula | C20H14BrFN2O2S |
| Molecular Weight | 445.31 g/mol |
| Exact Mass | 443.99 |
| IUPAC Name | 6-[2-(3-bromophenyl)-2-oxoethyl]sulfanyl-N-(4-fluorophenyl)pyridine-3-carboxamide |
| SMILES | O=C(CSc1ccc(C(=O)Nc2ccc(F)cc2)cn1)c1cccc(Br)c1 |
| InChI | InChI=1S/C20H14BrFN2O2S/c21-15-3-1-2-13(10-15)18(25)12-27-19-9-4-14(11-23-19)20(26)24-17-7-5-16(22)6-8-17/h1-11H,12H2,(H,24,26) |
| InChIKey | XQZJRZRMHCEGJH-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.31 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |