C22H15FN2O2S2 — CID 91937301
6-[2-(1-benzothiophen-5-yl)-2-oxoethyl]sulfanyl-N-(4-fluorophenyl)pyridine-3-carboxamide (PubChem CID 91937301) has the molecular formula C22H15FN2O2S2 and a molecular weight of 422.51 g/mol. Its IUPAC name is 6-[2-(1-benzothiophen-5-yl)-2-oxoethyl]sulfanyl-N-(4-fluorophenyl)pyridine-3-carboxamide.
| Compound Name | 6-[2-(1-benzothiophen-5-yl)-2-oxoethyl]sulfanyl-N-(4-fluorophenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 91937301 |
| Molecular Formula | C22H15FN2O2S2 |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | 6-[2-(1-benzothiophen-5-yl)-2-oxoethyl]sulfanyl-N-(4-fluorophenyl)pyridine-3-carboxamide |
| SMILES | O=C(CSc1ccc(C(=O)Nc2ccc(F)cc2)cn1)c1ccc2sccc2c1 |
| InChI | InChI=1S/C22H15FN2O2S2/c23-17-3-5-18(6-4-17)25-22(27)16-2-8-21(24-12-16)29-13-19(26)14-1-7-20-15(11-14)9-10-28-20/h1-12H,13H2,(H,25,27) |
| InChIKey | SGSJWIIMXPUUEB-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |