C20H16BF3N2O4S — CID 59446381
[2-[[5-[[4-(trifluoromethoxy)phenyl]carbamoyl]-2-pyridinyl]sulfanylmethyl]phenyl]boronic acid (PubChem CID 59446381) has the molecular formula C20H16BF3N2O4S and a molecular weight of 448.23 g/mol. Its IUPAC name is [2-[[5-[[4-(trifluoromethoxy)phenyl]carbamoyl]-2-pyridinyl]sulfanylmethyl]phenyl]boronic acid.
| Compound Name | [2-[[5-[[4-(trifluoromethoxy)phenyl]carbamoyl]-2-pyridinyl]sulfanylmethyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 59446381 |
| Molecular Formula | C20H16BF3N2O4S |
| Molecular Weight | 448.23 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | [2-[[5-[[4-(trifluoromethoxy)phenyl]carbamoyl]-2-pyridinyl]sulfanylmethyl]phenyl]boronic acid |
| SMILES | O=C(Nc1ccc(OC(F)(F)F)cc1)c1ccc(SCc2ccccc2B(O)O)nc1 |
| InChI | InChI=1S/C20H16BF3N2O4S/c22-20(23,24)30-16-8-6-15(7-9-16)26-19(27)13-5-10-18(25-11-13)31-12-14-3-1-2-4-17(14)21(28)29/h1-11,28-29H,12H2,(H,26,27) |
| InChIKey | PXFGEOGWPQQGBH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.23 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|