C25H33BClN3O4 — CID 174139301
N-[4-(2-chloropropan-2-yloxy)phenyl]-6-pyrrolidin-1-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxamide (PubChem CID 174139301) has the molecular formula C25H33BClN3O4 and a molecular weight of 485.82 g/mol. Its IUPAC name is N-[4-(2-chloropropan-2-yloxy)phenyl]-6-pyrrolidin-1-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxamide.
| Compound Name | N-[4-(2-chloropropan-2-yloxy)phenyl]-6-pyrrolidin-1-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 174139301 |
| Molecular Formula | C25H33BClN3O4 |
| Molecular Weight | 485.82 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | N-[4-(2-chloropropan-2-yloxy)phenyl]-6-pyrrolidin-1-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxamide |
| SMILES | CC(C)(Cl)Oc1ccc(NC(=O)c2cnc(N3CCCC3)c(B3OC(C)(C)C(C)(C)O3)c2)cc1 |
| InChI | InChI=1S/C25H33BClN3O4/c1-23(2)24(3,4)34-26(33-23)20-15-17(16-28-21(20)30-13-7-8-14-30)22(31)29-18-9-11-19(12-10-18)32-25(5,6)27/h9-12,15-16H,7-8,13-14H2,1-6H3,(H,29,31) |
| InChIKey | SLPOHAMHOSBYCK-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.82 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|