C17H23BO3S — CID 169458219
S-[3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-enyl] ethanethioate (PubChem CID 169458219) has the molecular formula C17H23BO3S and a molecular weight of 318.25 g/mol. Its IUPAC name is S-[3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-enyl] ethanethioate.
| Compound Name | S-[3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-enyl] ethanethioate |
|---|---|
| PubChem CID | 169458219 |
| Molecular Formula | C17H23BO3S |
| Molecular Weight | 318.25 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | S-[3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-enyl] ethanethioate |
| SMILES | CC(=O)SCC=Cc1cccc(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C17H23BO3S/c1-13(19)22-11-7-9-14-8-6-10-15(12-14)18-20-16(2,3)17(4,5)21-18/h6-10,12H,11H2,1-5H3 |
| InChIKey | WPZACSHBXUBCRL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.25 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|