C20H28BNO3 — CID 171939449
8-azabicyclo[3.2.1]octan-3-yl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone (PubChem CID 171939449) has the molecular formula C20H28BNO3 and a molecular weight of 341.26 g/mol. Its IUPAC name is 8-azabicyclo[3.2.1]octan-3-yl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone.
| Compound Name | 8-azabicyclo[3.2.1]octan-3-yl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone |
|---|---|
| PubChem CID | 171939449 |
| Molecular Formula | C20H28BNO3 |
| Molecular Weight | 341.26 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | 8-azabicyclo[3.2.1]octan-3-yl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanone |
| SMILES | CC1(C)OB(c2cccc(C(=O)C3CC4CCC(C3)N4)c2)OC1(C)C |
| InChI | InChI=1S/C20H28BNO3/c1-19(2)20(3,4)25-21(24-19)15-7-5-6-13(10-15)18(23)14-11-16-8-9-17(12-14)22-16/h5-7,10,14,16-17,22H,8-9,11-12H2,1-4H3 |
| InChIKey | ZDUMQBYCZABWDC-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.26 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|