C12H14ClN — CID 144648595
2-chloro-3-[(2E,4Z)-hepta-2,4-dien-3-yl]pyridine (PubChem CID 144648595) has the molecular formula C12H14ClN and a molecular weight of 207.70 g/mol. Its IUPAC name is 2-chloro-3-[(2E,4Z)-hepta-2,4-dien-3-yl]pyridine.
| Compound Name | 2-chloro-3-[(2E,4Z)-hepta-2,4-dien-3-yl]pyridine |
|---|---|
| PubChem CID | 144648595 |
| Molecular Formula | C12H14ClN |
| Molecular Weight | 207.70 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 2-chloro-3-[(2E,4Z)-hepta-2,4-dien-3-yl]pyridine |
| SMILES | C/C=C(\C=C/CC)c1cccnc1Cl |
| InChI | InChI=1S/C12H14ClN/c1-3-5-7-10(4-2)11-8-6-9-14-12(11)13/h4-9H,3H2,1-2H3/b7-5-,10-4+ |
| InChIKey | PQHGFKYNRJVURL-ACUVPTBSSA-N |
| XLogP | 4.10 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.70 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|