C27H27NO3S — CID 25227758
N-[(Z)-4-(4-methoxyphenyl)-6-(4-methylphenyl)hex-3-en-5-ynyl]-4-methylbenzenesulfonamide (PubChem CID 25227758) has the molecular formula C27H27NO3S and a molecular weight of 445.58 g/mol. Its IUPAC name is N-[(Z)-4-(4-methoxyphenyl)-6-(4-methylphenyl)hex-3-en-5-ynyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(Z)-4-(4-methoxyphenyl)-6-(4-methylphenyl)hex-3-en-5-ynyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 25227758 |
| Molecular Formula | C27H27NO3S |
| Molecular Weight | 445.58 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | N-[(Z)-4-(4-methoxyphenyl)-6-(4-methylphenyl)hex-3-en-5-ynyl]-4-methylbenzenesulfonamide |
| SMILES | COc1ccc(/C(C#Cc2ccc(C)cc2)=C/CCNS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C27H27NO3S/c1-21-6-10-23(11-7-21)12-13-24(25-14-16-26(31-3)17-15-25)5-4-20-28-32(29,30)27-18-8-22(2)9-19-27/h5-11,14-19,28H,4,20H2,1-3H3/b24-5+ |
| InChIKey | NIKPRKACHOJGDM-ZXKDJJQISA-N |
| XLogP | 5.12 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.58 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|