C26H28N2O6S — CID 73292464
4-methyl-N-[3-(3-nitrophenyl)prop-2-ynyl]-N-[2-oxo-2-(1,4,4-trimethyl-2-oxocyclopentyl)ethyl]benzenesulfonamide (PubChem CID 73292464) has the molecular formula C26H28N2O6S and a molecular weight of 496.59 g/mol. Its IUPAC name is 4-methyl-N-[3-(3-nitrophenyl)prop-2-ynyl]-N-[2-oxo-2-(1,4,4-trimethyl-2-oxocyclopentyl)ethyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[3-(3-nitrophenyl)prop-2-ynyl]-N-[2-oxo-2-(1,4,4-trimethyl-2-oxocyclopentyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 73292464 |
| Molecular Formula | C26H28N2O6S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | 4-methyl-N-[3-(3-nitrophenyl)prop-2-ynyl]-N-[2-oxo-2-(1,4,4-trimethyl-2-oxocyclopentyl)ethyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC#Cc2cccc([N+](=O)[O-])c2)CC(=O)C2(C)CC(C)(C)CC2=O)cc1 |
| InChI | InChI=1S/C26H28N2O6S/c1-19-10-12-22(13-11-19)35(33,34)27(14-6-8-20-7-5-9-21(15-20)28(31)32)17-24(30)26(4)18-25(2,3)16-23(26)29/h5,7,9-13,15H,14,16-18H2,1-4H3 |
| InChIKey | WYVSEEGLORQROY-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 114.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|