C22H23BrN2O4S — CID 57327438
[5-[[(E)-(4-bromophenyl)methylideneamino]-(4-methylphenyl)sulfonylamino]-2-methylpent-3-yn-2-yl] acetate (PubChem CID 57327438) has the molecular formula C22H23BrN2O4S and a molecular weight of 491.41 g/mol. Its IUPAC name is [5-[[(E)-(4-bromophenyl)methylideneamino]-(4-methylphenyl)sulfonylamino]-2-methylpent-3-yn-2-yl] acetate.
| Compound Name | [5-[[(E)-(4-bromophenyl)methylideneamino]-(4-methylphenyl)sulfonylamino]-2-methylpent-3-yn-2-yl] acetate |
|---|---|
| PubChem CID | 57327438 |
| Molecular Formula | C22H23BrN2O4S |
| Molecular Weight | 491.41 g/mol |
| Exact Mass | 490.06 |
| IUPAC Name | [5-[[(E)-(4-bromophenyl)methylideneamino]-(4-methylphenyl)sulfonylamino]-2-methylpent-3-yn-2-yl] acetate |
| SMILES | CC(=O)OC(C)(C)C#CCN(/N=C/c1ccc(Br)cc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H23BrN2O4S/c1-17-6-12-21(13-7-17)30(27,28)25(15-5-14-22(3,4)29-18(2)26)24-16-19-8-10-20(23)11-9-19/h6-13,16H,15H2,1-4H3/b24-16+ |
| InChIKey | CDRNFBUDQNAPOK-LFVJCYFKSA-N |
| XLogP | 4.13 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.41 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|