C24H23BrN2O3S — CID 177432918
N-benzyl-N-[(E)-3-[(E)-(4-bromophenyl)methylideneamino]oxyprop-1-enyl]-4-methylbenzenesulfonamide (PubChem CID 177432918) has the molecular formula C24H23BrN2O3S and a molecular weight of 499.43 g/mol. Its IUPAC name is N-benzyl-N-[(E)-3-[(E)-(4-bromophenyl)methylideneamino]oxyprop-1-enyl]-4-methylbenzenesulfonamide.
| Compound Name | N-benzyl-N-[(E)-3-[(E)-(4-bromophenyl)methylideneamino]oxyprop-1-enyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 177432918 |
| Molecular Formula | C24H23BrN2O3S |
| Molecular Weight | 499.43 g/mol |
| Exact Mass | 498.06 |
| IUPAC Name | N-benzyl-N-[(E)-3-[(E)-(4-bromophenyl)methylideneamino]oxyprop-1-enyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(/C=C/CO/N=C/c2ccc(Br)cc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C24H23BrN2O3S/c1-20-8-14-24(15-9-20)31(28,29)27(19-22-6-3-2-4-7-22)16-5-17-30-26-18-21-10-12-23(25)13-11-21/h2-16,18H,17,19H2,1H3/b16-5+,26-18+ |
| InChIKey | FUXGRLRBIOONLE-JCXFIBSJSA-N |
| XLogP | 5.51 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.43 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|