C23H21FN2O3S — CID 177497660
N-[(E)-3-[(E)-benzylideneamino]oxyprop-1-enyl]-N-(4-fluorophenyl)-4-methylbenzenesulfonamide (PubChem CID 177497660) has the molecular formula C23H21FN2O3S and a molecular weight of 424.50 g/mol. Its IUPAC name is N-[(E)-3-[(E)-benzylideneamino]oxyprop-1-enyl]-N-(4-fluorophenyl)-4-methylbenzenesulfonamide.
| Compound Name | N-[(E)-3-[(E)-benzylideneamino]oxyprop-1-enyl]-N-(4-fluorophenyl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 177497660 |
| Molecular Formula | C23H21FN2O3S |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | N-[(E)-3-[(E)-benzylideneamino]oxyprop-1-enyl]-N-(4-fluorophenyl)-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(/C=C/CO/N=C/c2ccccc2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C23H21FN2O3S/c1-19-8-14-23(15-9-19)30(27,28)26(22-12-10-21(24)11-13-22)16-5-17-29-25-18-20-6-3-2-4-7-20/h2-16,18H,17H2,1H3/b16-5+,25-18+ |
| InChIKey | HLBOKGPIHAADAQ-FCFMWSKQSA-N |
| XLogP | 4.89 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|