C29H33NO4S2 — CID 25198339
ethyl (Z)-7-[benzyl-(4-methylphenyl)sulfonylamino]-6-phenylsulfanylhept-6-enoate (PubChem CID 25198339) has the molecular formula C29H33NO4S2 and a molecular weight of 523.72 g/mol. Its IUPAC name is ethyl (Z)-7-[benzyl-(4-methylphenyl)sulfonylamino]-6-phenylsulfanylhept-6-enoate.
| Compound Name | ethyl (Z)-7-[benzyl-(4-methylphenyl)sulfonylamino]-6-phenylsulfanylhept-6-enoate |
|---|---|
| PubChem CID | 25198339 |
| Molecular Formula | C29H33NO4S2 |
| Molecular Weight | 523.72 g/mol |
| Exact Mass | 523.19 |
| IUPAC Name | ethyl (Z)-7-[benzyl-(4-methylphenyl)sulfonylamino]-6-phenylsulfanylhept-6-enoate |
| SMILES | CCOC(=O)CCCC/C(=C/N(Cc1ccccc1)S(=O)(=O)c1ccc(C)cc1)Sc1ccccc1 |
| InChI | InChI=1S/C29H33NO4S2/c1-3-34-29(31)17-11-10-16-27(35-26-14-8-5-9-15-26)23-30(22-25-12-6-4-7-13-25)36(32,33)28-20-18-24(2)19-21-28/h4-9,12-15,18-21,23H,3,10-11,16-17,22H2,1-2H3/b27-23- |
| InChIKey | IELSOWWTBBLIQP-VYIQYICTSA-N |
| XLogP | 6.94 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.72 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|