C17H20Cl3NO3S — CID 11683284
2,2,2-trichloro-N-(4-methylphenyl)sulfonyl-N-octa-1,7-dien-3-ylacetamide (PubChem CID 11683284) has the molecular formula C17H20Cl3NO3S and a molecular weight of 424.78 g/mol. Its IUPAC name is 2,2,2-trichloro-N-(4-methylphenyl)sulfonyl-N-octa-1,7-dien-3-ylacetamide.
| Compound Name | 2,2,2-trichloro-N-(4-methylphenyl)sulfonyl-N-octa-1,7-dien-3-ylacetamide |
|---|---|
| PubChem CID | 11683284 |
| Molecular Formula | C17H20Cl3NO3S |
| Molecular Weight | 424.78 g/mol |
| Exact Mass | 423.02 |
| IUPAC Name | 2,2,2-trichloro-N-(4-methylphenyl)sulfonyl-N-octa-1,7-dien-3-ylacetamide |
| SMILES | C=CCCCC(C=C)N(C(=O)C(Cl)(Cl)Cl)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H20Cl3NO3S/c1-4-6-7-8-14(5-2)21(16(22)17(18,19)20)25(23,24)15-11-9-13(3)10-12-15/h4-5,9-12,14H,1-2,6-8H2,3H3 |
| InChIKey | QRYGSSKKLDWZPU-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.78 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|