C19H28N2O3S — CID 2175357
N-[2-(cyclohexen-1-yl)ethyl]-2-(2,3-dimethyl-N-methylsulfonylanilino)acetamide (PubChem CID 2175357) has the molecular formula C19H28N2O3S and a molecular weight of 364.51 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-(2,3-dimethyl-N-methylsulfonylanilino)acetamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-(2,3-dimethyl-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 2175357 |
| Molecular Formula | C19H28N2O3S |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-(2,3-dimethyl-N-methylsulfonylanilino)acetamide |
| SMILES | Cc1cccc(N(CC(=O)NCCC2=CCCCC2)S(C)(=O)=O)c1C |
| InChI | InChI=1S/C19H28N2O3S/c1-15-8-7-11-18(16(15)2)21(25(3,23)24)14-19(22)20-13-12-17-9-5-4-6-10-17/h7-9,11H,4-6,10,12-14H2,1-3H3,(H,20,22) |
| InChIKey | ZBOFHTHLNMZHMO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|