C22H27ClN2O4S — CID 92647774
N-(4-butylphenyl)-2-(4-chloro-2-pyrrolidin-1-ylsulfonylphenoxy)acetamide (PubChem CID 92647774) has the molecular formula C22H27ClN2O4S and a molecular weight of 450.99 g/mol. Its IUPAC name is N-(4-butylphenyl)-2-(4-chloro-2-pyrrolidin-1-ylsulfonylphenoxy)acetamide.
| Compound Name | N-(4-butylphenyl)-2-(4-chloro-2-pyrrolidin-1-ylsulfonylphenoxy)acetamide |
|---|---|
| PubChem CID | 92647774 |
| Molecular Formula | C22H27ClN2O4S |
| Molecular Weight | 450.99 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | N-(4-butylphenyl)-2-(4-chloro-2-pyrrolidin-1-ylsulfonylphenoxy)acetamide |
| SMILES | CCCCc1ccc(NC(=O)COc2ccc(Cl)cc2S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C22H27ClN2O4S/c1-2-3-6-17-7-10-19(11-8-17)24-22(26)16-29-20-12-9-18(23)15-21(20)30(27,28)25-13-4-5-14-25/h7-12,15H,2-6,13-14,16H2,1H3,(H,24,26) |
| InChIKey | ZEUNGBMVTOFFND-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.99 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |