C18H20ClN3O6S2 — CID 92647738
2-(4-chloro-2-pyrrolidin-1-ylsulfonylphenoxy)-N-(4-sulfamoylphenyl)acetamide (PubChem CID 92647738) has the molecular formula C18H20ClN3O6S2 and a molecular weight of 473.96 g/mol. Its IUPAC name is 2-(4-chloro-2-pyrrolidin-1-ylsulfonylphenoxy)-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-(4-chloro-2-pyrrolidin-1-ylsulfonylphenoxy)-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 92647738 |
| Molecular Formula | C18H20ClN3O6S2 |
| Molecular Weight | 473.96 g/mol |
| Exact Mass | 473.05 |
| IUPAC Name | 2-(4-chloro-2-pyrrolidin-1-ylsulfonylphenoxy)-N-(4-sulfamoylphenyl)acetamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)COc2ccc(Cl)cc2S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C18H20ClN3O6S2/c19-13-3-8-16(17(11-13)30(26,27)22-9-1-2-10-22)28-12-18(23)21-14-4-6-15(7-5-14)29(20,24)25/h3-8,11H,1-2,9-10,12H2,(H,21,23)(H2,20,24,25) |
| InChIKey | LJMWXEDBWPSVCD-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.96 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |